ARRY-520 - CAS# 885060-09-3 azone Maleate 10(8):1500-8

10(8):1500-8

and also limited connective tissue ingrowth

Anti-pcsk9 compounds and methods for the treatment and/or prevention of cardiovascular diseases

Smiles: CC1NC(=O)NC(C=1C(=O)NC1C=C2C=NNC2=CC=1)C1C=CC(F)=CC=1

ARRY-520 - CAS# 885060-09-3 azone Maleate 10(8):1500-8Filanesib, also known as ARRY 520, is a synthetic, small molecule targeting the kinesin spindle protein (KSP) with potential antineoplastic activity. KSP inhibitor ARRY 520 specifically inhibits KSP (kinesin 5 or Eg5), resulting in activation of the spindle assembly checkpoint, induction of cell cycle arrest during the mitotic phase, and consequently cell death in tumor cells that are actively dividing. Because KSP is not involved in postmitotic